C23H25BN3O — CID 156818687
CID 156818687 (PubChem CID 156818687) has the molecular formula C23H25BN3O and a molecular weight of 370.29 g/mol.
| Compound Name | CID 156818687 |
|---|---|
| PubChem CID | 156818687 |
| Molecular Formula | C23H25BN3O |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | — |
| SMILES | CC.[B]c1ccnc(CNC(=O)c2ccc3c(c2)[C@](C)(C#N)CC2=C([CH]2)C3)c1.[H][H] |
| InChI | InChI=1S/C21H17BN3O.C2H6.H2/c1-21(12-23)10-16-7-15(16)6-13-2-3-14(8-19(13)21)20(26)25-11-18-9-17(22)4-5-24-18;1-2;/h2-5,7-9H,6,10-11H2,1H3,(H,25,26);1-2H3;1H/t21-;;/m0../s1 |
| InChIKey | LIGSLHKLPGFDGX-FGJQBABTSA-N |
| XLogP | 3.32 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|