C28H23N3O4 — CID 156819006
methyl 3-[2-[2-[[[(4R)-4-cyano-4-methyl-2,3-dihydrochromene-6-carbonyl]amino]methyl]-4-pyridinyl]ethynyl]benzoate (PubChem CID 156819006) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is methyl 3-[2-[2-[[[(4R)-4-cyano-4-methyl-2,3-dihydrochromene-6-carbonyl]amino]methyl]-4-pyridinyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[2-[[[(4R)-4-cyano-4-methyl-2,3-dihydrochromene-6-carbonyl]amino]methyl]-4-pyridinyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 156819006 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | methyl 3-[2-[2-[[[(4R)-4-cyano-4-methyl-2,3-dihydrochromene-6-carbonyl]amino]methyl]-4-pyridinyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2ccnc(CNC(=O)c3ccc4c(c3)[C@](C)(C#N)CCO4)c2)c1 |
| InChI | InChI=1S/C28H23N3O4/c1-28(18-29)11-13-35-25-9-8-21(16-24(25)28)26(32)31-17-23-15-20(10-12-30-23)7-6-19-4-3-5-22(14-19)27(33)34-2/h3-5,8-10,12,14-16H,11,13,17H2,1-2H3,(H,31,32)/t28-/m0/s1 |
| InChIKey | LMRCVENEUGDSHT-NDEPHWFRSA-N |
| XLogP | 3.76 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|