C30H28FIN3O4- — CID 156818894
CID 156818894 (PubChem CID 156818894) has the molecular formula C30H28FIN3O4- and a molecular weight of 640.47 g/mol.
| Compound Name | CID 156818894 |
|---|---|
| PubChem CID | 156818894 |
| Molecular Formula | C30H28FIN3O4- |
| Molecular Weight | 640.47 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | — |
| SMILES | C[C@@]1(F)COCc2ccc(C(=O)NCC3=C[I-]C=c4ccc(-c5cccc(C6(O)CCOC6)n5)nc4=C3)cc21 |
| InChI | InChI=1S/C30H28FIN3O4/c1-29(31)17-39-16-22-6-5-20(12-23(22)29)28(36)33-15-19-11-26-21(14-32-13-19)7-8-25(34-26)24-3-2-4-27(35-24)30(37)9-10-38-18-30/h2-8,11-14,37H,9-10,15-18H2,1H3,(H,33,36)/q-1/t29-,30?/m1/s1 |
| InChIKey | HNUNQDXQTQVMSX-IDCGIGBZSA-N |
| XLogP | -0.60 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.47 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|