C30H31IN5O2- — CID 156819384
CID 156819384 (PubChem CID 156819384) has the molecular formula C30H31IN5O2- and a molecular weight of 620.52 g/mol.
| Compound Name | CID 156819384 |
|---|---|
| PubChem CID | 156819384 |
| Molecular Formula | C30H31IN5O2- |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | — |
| SMILES | CC1C2=CC(CNC(=O)c3ccc4c(c3)[C@](C)(C#N)COC4)=C[I-]C=C2CCN1c1cncc(C2CC2)n1 |
| InChI | InChI=1S/C30H31IN5O2/c1-19-25-9-20(13-34-29(37)22-5-6-24-16-38-18-30(2,17-32)26(24)10-22)11-31-12-23(25)7-8-36(19)28-15-33-14-27(35-28)21-3-4-21/h5-6,9-12,14-15,19,21H,3-4,7-8,13,16,18H2,1-2H3,(H,34,37)/q-1/t19?,30-/m1/s1 |
| InChIKey | NAWGRXASBASVDH-PPRAREMJSA-N |
| XLogP | 1.49 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|