C21H24BrN3O2 — CID 156818907
tert-butyl N-[(6-benzyl-2,6-naphthyridin-6-ium-3-yl)methyl]carbamate bromide (PubChem CID 156818907) has the molecular formula C21H24BrN3O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is tert-butyl N-[(6-benzyl-2,6-naphthyridin-6-ium-3-yl)methyl]carbamate bromide.
| Compound Name | tert-butyl N-[(6-benzyl-2,6-naphthyridin-6-ium-3-yl)methyl]carbamate bromide |
|---|---|
| PubChem CID | 156818907 |
| Molecular Formula | C21H24BrN3O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | tert-butyl N-[(6-benzyl-2,6-naphthyridin-6-ium-3-yl)methyl]carbamate bromide |
| SMILES | CC(C)(C)OC(=O)NCc1cc2c[n+](Cc3ccccc3)ccc2cn1.[Br-] |
| InChI | InChI=1S/C21H23N3O2.BrH/c1-21(2,3)26-20(25)23-13-19-11-18-15-24(10-9-17(18)12-22-19)14-16-7-5-4-6-8-16;/h4-12,15H,13-14H2,1-3H3;1H |
| InChIKey | MOGXOTAHDKCMOE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|