C18H18ClN3O2 — CID 156819355
2-[(4-pyrrolidin-3-yl-2-pyridinyl)methyl]isoindole-1,3-dione;hydrochloride (PubChem CID 156819355) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-[(4-pyrrolidin-3-yl-2-pyridinyl)methyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[(4-pyrrolidin-3-yl-2-pyridinyl)methyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 156819355 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[(4-pyrrolidin-3-yl-2-pyridinyl)methyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)N1Cc1cc(C2CCNC2)ccn1 |
| InChI | InChI=1S/C18H17N3O2.ClH/c22-17-15-3-1-2-4-16(15)18(23)21(17)11-14-9-12(6-8-20-14)13-5-7-19-10-13;/h1-4,6,8-9,13,19H,5,7,10-11H2;1H |
| InChIKey | HSACVPYYOVCAOP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|