C25H37NS — CID 156821149
N,N-dimethyl-2-[4-[(Z)-2-methylidenedodec-10-enyl]-1-benzothiophen-3-yl]ethanamine (PubChem CID 156821149) has the molecular formula C25H37NS and a molecular weight of 383.65 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[(Z)-2-methylidenedodec-10-enyl]-1-benzothiophen-3-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-[(Z)-2-methylidenedodec-10-enyl]-1-benzothiophen-3-yl]ethanamine |
|---|---|
| PubChem CID | 156821149 |
| Molecular Formula | C25H37NS |
| Molecular Weight | 383.65 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N,N-dimethyl-2-[4-[(Z)-2-methylidenedodec-10-enyl]-1-benzothiophen-3-yl]ethanamine |
| SMILES | C=C(CCCCCCC/C=C\C)Cc1cccc2scc(CCN(C)C)c12 |
| InChI | InChI=1S/C25H37NS/c1-5-6-7-8-9-10-11-12-14-21(2)19-22-15-13-16-24-25(22)23(20-27-24)17-18-26(3)4/h5-6,13,15-16,20H,2,7-12,14,17-19H2,1,3-4H3/b6-5- |
| InChIKey | XYBBJHZOSBEQQP-WAYWQWQTSA-N |
| XLogP | 7.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.65 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|