C31H46N2O2 — CID 178091324
[4-[2-(dimethylamino)ethyl]isoquinolin-5-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 178091324) has the molecular formula C31H46N2O2 and a molecular weight of 478.72 g/mol. Its IUPAC name is [4-[2-(dimethylamino)ethyl]isoquinolin-5-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [4-[2-(dimethylamino)ethyl]isoquinolin-5-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 178091324 |
| Molecular Formula | C31H46N2O2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | [4-[2-(dimethylamino)ethyl]isoquinolin-5-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Oc1cccc2cncc(CCN(C)C)c12 |
| InChI | InChI=1S/C31H46N2O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-30(34)35-29-21-19-20-27-25-32-26-28(31(27)29)23-24-33(2)3/h8-9,11-12,19-21,25-26H,4-7,10,13-18,22-24H2,1-3H3/b9-8-,12-11- |
| InChIKey | DCPQRAFOOLRPLG-MURFETPASA-N |
| XLogP | 8.06 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|