C31H30N8O2 — CID 156821217
1-[4-[4-[4-[4-[ethenyl(methyl)amino]-3-methylphenoxy]-3-ethynylanilino]pyrimido[5,4-d]pyrimidin-6-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 156821217) has the molecular formula C31H30N8O2 and a molecular weight of 546.64 g/mol. Its IUPAC name is 1-[4-[4-[4-[4-[ethenyl(methyl)amino]-3-methylphenoxy]-3-ethynylanilino]pyrimido[5,4-d]pyrimidin-6-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[4-[4-[ethenyl(methyl)amino]-3-methylphenoxy]-3-ethynylanilino]pyrimido[5,4-d]pyrimidin-6-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156821217 |
| Molecular Formula | C31H30N8O2 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 1-[4-[4-[4-[4-[ethenyl(methyl)amino]-3-methylphenoxy]-3-ethynylanilino]pyrimido[5,4-d]pyrimidin-6-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C#Cc1cc(Nc2ncnc3cnc(N4CCN(C(=O)C=C)CC4)nc23)ccc1Oc1ccc(N(C)C=C)c(C)c1 |
| InChI | InChI=1S/C31H30N8O2/c1-6-22-18-23(9-12-27(22)41-24-10-11-26(21(4)17-24)37(5)8-3)35-30-29-25(33-20-34-30)19-32-31(36-29)39-15-13-38(14-16-39)28(40)7-2/h1,7-12,17-20H,2-3,13-16H2,4-5H3,(H,33,34,35) |
| InChIKey | XCHYIFFWROUCQU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|