C15H23F2N3O2 — CID 156823462
tert-butyl N-[1-cyclohexyl-3-(difluoromethyl)pyrazol-4-yl]carbamate (PubChem CID 156823462) has the molecular formula C15H23F2N3O2 and a molecular weight of 315.36 g/mol. Its IUPAC name is tert-butyl N-[1-cyclohexyl-3-(difluoromethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-cyclohexyl-3-(difluoromethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 156823462 |
| Molecular Formula | C15H23F2N3O2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | tert-butyl N-[1-cyclohexyl-3-(difluoromethyl)pyrazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cn(C2CCCCC2)nc1C(F)F |
| InChI | InChI=1S/C15H23F2N3O2/c1-15(2,3)22-14(21)18-11-9-20(19-12(11)13(16)17)10-7-5-4-6-8-10/h9-10,13H,4-8H2,1-3H3,(H,18,21) |
| InChIKey | PWKRPDPTYBMSNA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |