C20H39F3N6O4 — CID 156823901
tert-butyl N-[3-[3-(3-formamidopropanoylamino)propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate;N'-methylethanimidamide (PubChem CID 156823901) has the molecular formula C20H39F3N6O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(3-formamidopropanoylamino)propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate;N'-methylethanimidamide.
| Compound Name | tert-butyl N-[3-[3-(3-formamidopropanoylamino)propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate;N'-methylethanimidamide |
|---|---|
| PubChem CID | 156823901 |
| Molecular Formula | C20H39F3N6O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | tert-butyl N-[3-[3-(3-formamidopropanoylamino)propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate;N'-methylethanimidamide |
| SMILES | C/N=C(\C)N.CC(C)(C)OC(=O)NCCCN(CCCNC(=O)CCNC=O)CC(F)(F)F |
| InChI | InChI=1S/C17H31F3N4O4.C3H8N2/c1-16(2,3)28-15(27)23-8-5-11-24(12-17(18,19)20)10-4-7-22-14(26)6-9-21-13-25;1-3(4)5-2/h13H,4-12H2,1-3H3,(H,21,25)(H,22,26)(H,23,27);1-2H3,(H2,4,5) |
| InChIKey | LHOXVJFRBBGDLW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|