C17H31F3N4O4 — CID 156823902
tert-butyl N-[3-[3-(3-formamidopropanoylamino)propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate (PubChem CID 156823902) has the molecular formula C17H31F3N4O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(3-formamidopropanoylamino)propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(3-formamidopropanoylamino)propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 156823902 |
| Molecular Formula | C17H31F3N4O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | tert-butyl N-[3-[3-(3-formamidopropanoylamino)propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCNC(=O)CCNC=O)CC(F)(F)F |
| InChI | InChI=1S/C17H31F3N4O4/c1-16(2,3)28-15(27)23-8-5-11-24(12-17(18,19)20)10-4-7-22-14(26)6-9-21-13-25/h13H,4-12H2,1-3H3,(H,21,25)(H,22,26)(H,23,27) |
| InChIKey | IZUKKYLKMXQWLC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|