C10H18F2N2O3 — CID 59383108
tert-butyl N-[3-(2,2-difluoroethylamino)-3-oxopropyl]carbamate (PubChem CID 59383108) has the molecular formula C10H18F2N2O3 and a molecular weight of 252.26 g/mol. Its IUPAC name is tert-butyl N-[3-(2,2-difluoroethylamino)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,2-difluoroethylamino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 59383108 |
| Molecular Formula | C10H18F2N2O3 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | tert-butyl N-[3-(2,2-difluoroethylamino)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCC(F)F |
| InChI | InChI=1S/C10H18F2N2O3/c1-10(2,3)17-9(16)13-5-4-8(15)14-6-7(11)12/h7H,4-6H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | ZXQSQPKADRMQRJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |