C22H27N3O3 — CID 156824565
1-[(4-methoxyphenyl)methyl]-3-[4-[[(4R)-4-methyl-2-oxopiperidin-1-yl]methyl]phenyl]urea (PubChem CID 156824565) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[4-[[(4R)-4-methyl-2-oxopiperidin-1-yl]methyl]phenyl]urea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[4-[[(4R)-4-methyl-2-oxopiperidin-1-yl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 156824565 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[4-[[(4R)-4-methyl-2-oxopiperidin-1-yl]methyl]phenyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccc(CN3CC[C@@H](C)CC3=O)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-16-11-12-25(21(26)13-16)15-18-3-7-19(8-4-18)24-22(27)23-14-17-5-9-20(28-2)10-6-17/h3-10,16H,11-15H2,1-2H3,(H2,23,24,27)/t16-/m1/s1 |
| InChIKey | KUMYPCCXKIXULM-MRXNPFEDSA-N |
| XLogP | 3.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |