C19H22N2O4S — CID 166706420
1-[4-[(3S)-1,1-dioxothiolan-3-yl]phenyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 166706420) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-[4-[(3S)-1,1-dioxothiolan-3-yl]phenyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[4-[(3S)-1,1-dioxothiolan-3-yl]phenyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 166706420 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-[4-[(3S)-1,1-dioxothiolan-3-yl]phenyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccc([C@@H]3CCS(=O)(=O)C3)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-25-18-8-2-14(3-9-18)12-20-19(22)21-17-6-4-15(5-7-17)16-10-11-26(23,24)13-16/h2-9,16H,10-13H2,1H3,(H2,20,21,22)/t16-/m1/s1 |
| InChIKey | XTCBKTLUQZHYAH-MRXNPFEDSA-N |
| XLogP | 2.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |