C29H37N5O5 — CID 156825599
(3S)-3-[[(2S)-2-(3-amino-2-oxo-1-pyridinyl)-3-cyclohexylpropanoyl]amino]-N-benzyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide (PubChem CID 156825599) has the molecular formula C29H37N5O5 and a molecular weight of 535.65 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-(3-amino-2-oxo-1-pyridinyl)-3-cyclohexylpropanoyl]amino]-N-benzyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide.
| Compound Name | (3S)-3-[[(2S)-2-(3-amino-2-oxo-1-pyridinyl)-3-cyclohexylpropanoyl]amino]-N-benzyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 156825599 |
| Molecular Formula | C29H37N5O5 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (3S)-3-[[(2S)-2-(3-amino-2-oxo-1-pyridinyl)-3-cyclohexylpropanoyl]amino]-N-benzyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
| SMILES | Nc1cccn([C@@H](CC2CCCCC2)C(=O)N[C@@H](C[C@@H]2CCNC2=O)C(=O)C(=O)NCc2ccccc2)c1=O |
| InChI | InChI=1S/C29H37N5O5/c30-22-12-7-15-34(29(22)39)24(16-19-8-3-1-4-9-19)27(37)33-23(17-21-13-14-31-26(21)36)25(35)28(38)32-18-20-10-5-2-6-11-20/h2,5-7,10-12,15,19,21,23-24H,1,3-4,8-9,13-14,16-18,30H2,(H,31,36)(H,32,38)(H,33,37)/t21-,23-,24-/m0/s1 |
| InChIKey | AQHDOGWIZMUDMY-XWGVYQGASA-N |
| XLogP | 1.84 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|