C33H38F2N4O7 — CID 164731007
N-[(2S)-1-[[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide (PubChem CID 164731007) has the molecular formula C33H38F2N4O7 and a molecular weight of 640.68 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 164731007 |
| Molecular Formula | C33H38F2N4O7 |
| Molecular Weight | 640.68 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | N-[(2S)-1-[[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H](CC1CCCCC1)NC(=O)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C33H38F2N4O7/c34-33(35)45-26-14-13-23(18-27(26)46-33)30(42)39-25(16-20-8-3-1-4-9-20)31(43)38-24(17-22-12-7-15-36-29(22)41)28(40)32(44)37-19-21-10-5-2-6-11-21/h2,5-6,10-11,13-14,18,20,22,24-25H,1,3-4,7-9,12,15-17,19H2,(H,36,41)(H,37,44)(H,38,43)(H,39,42)/t22-,24-,25-/m0/s1 |
| InChIKey | OJXDGGXKBKAQQQ-HVCNVCAESA-N |
| XLogP | 3.36 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.68 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|