C16H16BrN3O2 — CID 156826360
1-[[4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-bromophenyl]methyl]imidazole-4-carboxylic acid (PubChem CID 156826360) has the molecular formula C16H16BrN3O2 and a molecular weight of 362.23 g/mol. Its IUPAC name is 1-[[4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-bromophenyl]methyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[[4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-bromophenyl]methyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 156826360 |
| Molecular Formula | C16H16BrN3O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 1-[[4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-bromophenyl]methyl]imidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccc(N3CC4CC4C3)cc2Br)cn1 |
| InChI | InChI=1S/C16H16BrN3O2/c17-14-4-13(20-6-11-3-12(11)7-20)2-1-10(14)5-19-8-15(16(21)22)18-9-19/h1-2,4,8-9,11-12H,3,5-7H2,(H,21,22) |
| InChIKey | OMMRPZBADSYCLH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |