About 1H-indol-6-yl thiocyanate;methane
1H-indol-6-yl thiocyanate;methane (PubChem CID 156828147) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 1H-indol-6-yl thiocyanate;methane.
Molecular Properties
| Compound Name | 1H-indol-6-yl thiocyanate;methane |
| PubChem CID | 156828147 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 1H-indol-6-yl thiocyanate;methane |
| SMILES | C.N#CSc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C9H6N2S.CH4/c10-6-12-8-2-1-7-3-4-11-9(7)5-8;/h1-5,11H;1H4 |
| InChIKey | POAIPRHNJVADAO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-6-yl thiocyanate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-6-yl thiocyanate;methane?
The IUPAC name of 1H-indol-6-yl thiocyanate;methane (CID 156828147) is 1H-indol-6-yl thiocyanate;methane.
What is the SMILES notation for 1H-indol-6-yl thiocyanate;methane?
The canonical SMILES for 1H-indol-6-yl thiocyanate;methane is C.N#CSc1ccc2cc[nH]c2c1.
What is the InChIKey of 1H-indol-6-yl thiocyanate;methane?
The InChIKey is POAIPRHNJVADAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2S.CH4/c10-6-12-8-2-1-7-3-4-11-9(7)5-8;/h1-5,11H;1H4.
What are the key properties of 1H-indol-6-yl thiocyanate;methane?
1H-indol-6-yl thiocyanate;methane has a molecular weight of 190.27 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-6-yl thiocyanate;methane is sourced from PubChem (CID 156828147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).