C23H20FN3O4S — CID 156828643
ethyl 2-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 156828643) has the molecular formula C23H20FN3O4S and a molecular weight of 453.50 g/mol. Its IUPAC name is ethyl 2-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 156828643 |
| Molecular Formula | C23H20FN3O4S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | ethyl 2-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H20FN3O4S/c1-2-31-19(28)18-17(14-6-4-3-5-7-14)26-22(32-18)27-21(30)23(12-13-23)20(29)25-16-10-8-15(24)9-11-16/h3-11H,2,12-13H2,1H3,(H,25,29)(H,26,27,30) |
| InChIKey | BXDHMKMQHJVPPG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|