C15H15N5 — CID 156830408
6-[[[cyclopropyl(pyrimidin-2-yl)methyl]amino]methyl]pyridine-3-carbonitrile (PubChem CID 156830408) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 6-[[[cyclopropyl(pyrimidin-2-yl)methyl]amino]methyl]pyridine-3-carbonitrile.
| Compound Name | 6-[[[cyclopropyl(pyrimidin-2-yl)methyl]amino]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 156830408 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-[[[cyclopropyl(pyrimidin-2-yl)methyl]amino]methyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(CNC(c2ncccn2)C2CC2)nc1 |
| InChI | InChI=1S/C15H15N5/c16-8-11-2-5-13(19-9-11)10-20-14(12-3-4-12)15-17-6-1-7-18-15/h1-2,5-7,9,12,14,20H,3-4,10H2 |
| InChIKey | HHPQPPPCDHGDNG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |