C11H12N2O — CID 126955007
6-(1-cyclopropylethoxy)pyridine-3-carbonitrile (PubChem CID 126955007) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-(1-cyclopropylethoxy)pyridine-3-carbonitrile.
| Compound Name | 6-(1-cyclopropylethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 126955007 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 6-(1-cyclopropylethoxy)pyridine-3-carbonitrile |
| SMILES | CC(Oc1ccc(C#N)cn1)C1CC1 |
| InChI | InChI=1S/C11H12N2O/c1-8(10-3-4-10)14-11-5-2-9(6-12)7-13-11/h2,5,7-8,10H,3-4H2,1H3 |
| InChIKey | KJXQICPXMARQJA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |