C18H17ClFN3O — CID 68795387
6-[1-[4-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile (PubChem CID 68795387) has the molecular formula C18H17ClFN3O and a molecular weight of 345.81 g/mol. Its IUPAC name is 6-[1-[4-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile.
| Compound Name | 6-[1-[4-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 68795387 |
| Molecular Formula | C18H17ClFN3O |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 6-[1-[4-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile |
| SMILES | CC(Oc1ccc(C#N)cn1)C1CNCC1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C18H17ClFN3O/c1-11(24-18-5-2-12(7-21)8-23-18)14-9-22-10-15(14)13-3-4-16(19)17(20)6-13/h2-6,8,11,14-15,22H,9-10H2,1H3 |
| InChIKey | GCSCMFLQMOCCOY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |