C18H20Cl2N2O — CID 59438157
5-chloro-2-[(1S)-1-[(3S,4S)-3-(4-chlorophenyl)piperidin-4-yl]ethoxy]pyridine (PubChem CID 59438157) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is 5-chloro-2-[(1S)-1-[(3S,4S)-3-(4-chlorophenyl)piperidin-4-yl]ethoxy]pyridine.
| Compound Name | 5-chloro-2-[(1S)-1-[(3S,4S)-3-(4-chlorophenyl)piperidin-4-yl]ethoxy]pyridine |
|---|---|
| PubChem CID | 59438157 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 5-chloro-2-[(1S)-1-[(3S,4S)-3-(4-chlorophenyl)piperidin-4-yl]ethoxy]pyridine |
| SMILES | C[C@H](Oc1ccc(Cl)cn1)[C@H]1CCNC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-12(23-18-7-6-15(20)10-22-18)16-8-9-21-11-17(16)13-2-4-14(19)5-3-13/h2-7,10,12,16-17,21H,8-9,11H2,1H3/t12-,16+,17+/m0/s1 |
| InChIKey | LTDNPMZKUBEOLP-JCURWCKSSA-N |
| XLogP | 4.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |