C22H28IN3O2S — CID 156831145
[3-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-2,5-dihydropyrrol-1-yl] thiohypoiodite;benzene;ethane (PubChem CID 156831145) has the molecular formula C22H28IN3O2S and a molecular weight of 525.46 g/mol. Its IUPAC name is [3-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-2,5-dihydropyrrol-1-yl] thiohypoiodite;benzene;ethane.
| Compound Name | [3-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-2,5-dihydropyrrol-1-yl] thiohypoiodite;benzene;ethane |
|---|---|
| PubChem CID | 156831145 |
| Molecular Formula | C22H28IN3O2S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | [3-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-2,5-dihydropyrrol-1-yl] thiohypoiodite;benzene;ethane |
| SMILES | CC.NC(=O)C(Cc1ccccc1)NC(=O)C1=CCN(SI)C1.c1ccccc1 |
| InChI | InChI=1S/C14H16IN3O2S.C6H6.C2H6/c15-21-18-7-6-11(9-18)14(20)17-12(13(16)19)8-10-4-2-1-3-5-10;1-2-4-6-5-3-1;1-2/h1-6,12H,7-9H2,(H2,16,19)(H,17,20);1-6H;1-2H3 |
| InChIKey | GKKSORNUABSVDW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|