C14H16IN3O2S — CID 156831146
[3-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-2,5-dihydropyrrol-1-yl] thiohypoiodite (PubChem CID 156831146) has the molecular formula C14H16IN3O2S and a molecular weight of 417.27 g/mol. Its IUPAC name is [3-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-2,5-dihydropyrrol-1-yl] thiohypoiodite.
| Compound Name | [3-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-2,5-dihydropyrrol-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 156831146 |
| Molecular Formula | C14H16IN3O2S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | [3-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-2,5-dihydropyrrol-1-yl] thiohypoiodite |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)C1=CCN(SI)C1 |
| InChI | InChI=1S/C14H16IN3O2S/c15-21-18-7-6-11(9-18)14(20)17-12(13(16)19)8-10-4-2-1-3-5-10/h1-6,12H,7-9H2,(H2,16,19)(H,17,20) |
| InChIKey | VXRWMGYWYJEWQM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|