C14H13IN2O2S — CID 156831204
ethyl 2-(4-cyanophenyl)-1-iodosulfanyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 156831204) has the molecular formula C14H13IN2O2S and a molecular weight of 400.24 g/mol. Its IUPAC name is ethyl 2-(4-cyanophenyl)-1-iodosulfanyl-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | ethyl 2-(4-cyanophenyl)-1-iodosulfanyl-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 156831204 |
| Molecular Formula | C14H13IN2O2S |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | ethyl 2-(4-cyanophenyl)-1-iodosulfanyl-2,5-dihydropyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=CCN(SI)C1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H13IN2O2S/c1-2-19-14(18)12-7-8-17(20-15)13(12)11-5-3-10(9-16)4-6-11/h3-7,13H,2,8H2,1H3 |
| InChIKey | GYZJEZSPPQDKAH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|