C13H13BrINO2S — CID 156831097
ethyl 2-(3-bromophenyl)-1-iodosulfanyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 156831097) has the molecular formula C13H13BrINO2S and a molecular weight of 454.13 g/mol. Its IUPAC name is ethyl 2-(3-bromophenyl)-1-iodosulfanyl-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | ethyl 2-(3-bromophenyl)-1-iodosulfanyl-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 156831097 |
| Molecular Formula | C13H13BrINO2S |
| Molecular Weight | 454.13 g/mol |
| Exact Mass | 452.89 |
| IUPAC Name | ethyl 2-(3-bromophenyl)-1-iodosulfanyl-2,5-dihydropyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=CCN(SI)C1c1cccc(Br)c1 |
| InChI | InChI=1S/C13H13BrINO2S/c1-2-18-13(17)11-6-7-16(19-15)12(11)9-4-3-5-10(14)8-9/h3-6,8,12H,2,7H2,1H3 |
| InChIKey | BLZNYRHINNDZNG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.13 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|