C18H19BrO5 — CID 56851088
diethyl 4-(3-bromophenyl)-6-methyl-4H-pyran-2,5-dicarboxylate (PubChem CID 56851088) has the molecular formula C18H19BrO5 and a molecular weight of 395.25 g/mol. Its IUPAC name is diethyl 4-(3-bromophenyl)-6-methyl-4H-pyran-2,5-dicarboxylate.
| Compound Name | diethyl 4-(3-bromophenyl)-6-methyl-4H-pyran-2,5-dicarboxylate |
|---|---|
| PubChem CID | 56851088 |
| Molecular Formula | C18H19BrO5 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | diethyl 4-(3-bromophenyl)-6-methyl-4H-pyran-2,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(c2cccc(Br)c2)C(C(=O)OCC)=C(C)O1 |
| InChI | InChI=1S/C18H19BrO5/c1-4-22-17(20)15-10-14(12-7-6-8-13(19)9-12)16(11(3)24-15)18(21)23-5-2/h6-10,14H,4-5H2,1-3H3 |
| InChIKey | VOQBKODGKYSZES-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |