C25H24F3N5O4 — CID 156831414
(17Z)-22-methoxy-N-methyl-6-(trifluoromethyl)-14,20-dioxa-2,4,8,27-tetrazatetracyclo[19.2.2.13,7.19,13]heptacosa-1(23),3,5,7(27),9,11,13(26),17,21,24-decaene-10-carboxamide (PubChem CID 156831414) has the molecular formula C25H24F3N5O4 and a molecular weight of 515.49 g/mol. Its IUPAC name is (17Z)-22-methoxy-N-methyl-6-(trifluoromethyl)-14,20-dioxa-2,4,8,27-tetrazatetracyclo[19.2.2.13,7.19,13]heptacosa-1(23),3,5,7(27),9,11,13(26),17,21,24-decaene-10-carboxamide.
| Compound Name | (17Z)-22-methoxy-N-methyl-6-(trifluoromethyl)-14,20-dioxa-2,4,8,27-tetrazatetracyclo[19.2.2.13,7.19,13]heptacosa-1(23),3,5,7(27),9,11,13(26),17,21,24-decaene-10-carboxamide |
|---|---|
| PubChem CID | 156831414 |
| Molecular Formula | C25H24F3N5O4 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (17Z)-22-methoxy-N-methyl-6-(trifluoromethyl)-14,20-dioxa-2,4,8,27-tetrazatetracyclo[19.2.2.13,7.19,13]heptacosa-1(23),3,5,7(27),9,11,13(26),17,21,24-decaene-10-carboxamide |
| SMILES | CNC(=O)c1ccc2cc1Nc1nc(ncc1C(F)(F)F)Nc1ccc(c(OC)c1)OC/C=C\CCO2 |
| InChI | InChI=1S/C25H24F3N5O4/c1-29-23(34)17-8-7-16-13-19(17)32-22-18(25(26,27)28)14-30-24(33-22)31-15-6-9-20(21(12-15)35-2)37-11-5-3-4-10-36-16/h3,5-9,12-14H,4,10-11H2,1-2H3,(H,29,34)(H2,30,31,32,33)/b5-3- |
| InChIKey | YVBKRXXQXCEOOJ-HYXAFXHYSA-N |
| XLogP | 5.07 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|