C31H35F3N6O6 — CID 54673322
methyl 3-[[(19Z)-6-(2,2,2-trifluoroethoxy)-15,24-dioxa-3,5,7,9,31-pentazatetracyclo[23.2.2.14,8.110,14]hentriaconta-1(28),4(31),5,7,10(30),11,13,19,25(29),26-decaene-13-carbonyl]amino]propanoate (PubChem CID 54673322) has the molecular formula C31H35F3N6O6 and a molecular weight of 644.65 g/mol. Its IUPAC name is methyl 3-[[(19Z)-6-(2,2,2-trifluoroethoxy)-15,24-dioxa-3,5,7,9,31-pentazatetracyclo[23.2.2.14,8.110,14]hentriaconta-1(28),4(31),5,7,10(30),11,13,19,25(29),26-decaene-13-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[(19Z)-6-(2,2,2-trifluoroethoxy)-15,24-dioxa-3,5,7,9,31-pentazatetracyclo[23.2.2.14,8.110,14]hentriaconta-1(28),4(31),5,7,10(30),11,13,19,25(29),26-decaene-13-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 54673322 |
| Molecular Formula | C31H35F3N6O6 |
| Molecular Weight | 644.65 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | methyl 3-[[(19Z)-6-(2,2,2-trifluoroethoxy)-15,24-dioxa-3,5,7,9,31-pentazatetracyclo[23.2.2.14,8.110,14]hentriaconta-1(28),4(31),5,7,10(30),11,13,19,25(29),26-decaene-13-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc2cc1OCCC/C=C\CCCOc1ccc(cc1)CNc1nc(nc(OCC(F)(F)F)n1)N2 |
| InChI | InChI=1S/C31H35F3N6O6/c1-43-26(41)14-15-35-27(42)24-13-10-22-18-25(24)45-17-7-5-3-2-4-6-16-44-23-11-8-21(9-12-23)19-36-28-38-29(37-22)40-30(39-28)46-20-31(32,33)34/h2-3,8-13,18H,4-7,14-17,19-20H2,1H3,(H,35,42)(H2,36,37,38,39,40)/b3-2- |
| InChIKey | LABBUQTUCUHINQ-IHWYPQMZSA-N |
| XLogP | 5.35 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|