C25H25F3N6O5S — CID 76707502
21,21-dioxo-5-(2,2,2-trifluoroethoxy)-14-oxa-21λ6-thia-2,4,6,8,22,31-hexazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),18,24,27-decaen-23-one (PubChem CID 76707502) has the molecular formula C25H25F3N6O5S and a molecular weight of 578.57 g/mol. Its IUPAC name is 21,21-dioxo-5-(2,2,2-trifluoroethoxy)-14-oxa-21λ6-thia-2,4,6,8,22,31-hexazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),18,24,27-decaen-23-one.
| Compound Name | 21,21-dioxo-5-(2,2,2-trifluoroethoxy)-14-oxa-21λ6-thia-2,4,6,8,22,31-hexazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),18,24,27-decaen-23-one |
|---|---|
| PubChem CID | 76707502 |
| Molecular Formula | C25H25F3N6O5S |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 21,21-dioxo-5-(2,2,2-trifluoroethoxy)-14-oxa-21λ6-thia-2,4,6,8,22,31-hexazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),18,24,27-decaen-23-one |
| SMILES | O=C1NS(=O)(=O)CC=CCCCOc2ccc(cc2)CNc2nc(nc(OCC(F)(F)F)n2)Nc2ccc1cc2 |
| InChI | InChI=1S/C25H25F3N6O5S/c26-25(27,28)16-39-24-32-22-29-15-17-5-11-20(12-6-17)38-13-3-1-2-4-14-40(36,37)34-21(35)18-7-9-19(10-8-18)30-23(31-22)33-24/h2,4-12H,1,3,13-16H2,(H,34,35)(H2,29,30,31,32,33) |
| InChIKey | DRLXJYBXYKTMNI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|