C27H29F3N6O3 — CID 58223039
5-(2,2,2-trifluoroethoxy)-2,4,6,8,22,31-hexazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),24,27-nonaene-14,23-dione (PubChem CID 58223039) has the molecular formula C27H29F3N6O3 and a molecular weight of 542.56 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethoxy)-2,4,6,8,22,31-hexazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),24,27-nonaene-14,23-dione.
| Compound Name | 5-(2,2,2-trifluoroethoxy)-2,4,6,8,22,31-hexazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),24,27-nonaene-14,23-dione |
|---|---|
| PubChem CID | 58223039 |
| Molecular Formula | C27H29F3N6O3 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 5-(2,2,2-trifluoroethoxy)-2,4,6,8,22,31-hexazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),3,5,7(31),10(30),11,13(29),24,27-nonaene-14,23-dione |
| SMILES | O=C1CCCCCCCNC(=O)c2ccc(cc2)Nc2nc(nc(OCC(F)(F)F)n2)NCc2ccc1cc2 |
| InChI | InChI=1S/C27H29F3N6O3/c28-27(29,30)17-39-26-35-24-32-16-18-7-9-19(10-8-18)22(37)6-4-2-1-3-5-15-31-23(38)20-11-13-21(14-12-20)33-25(34-24)36-26/h7-14H,1-6,15-17H2,(H,31,38)(H2,32,33,34,35,36) |
| InChIKey | UTMNEXXMZHHJFL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |