C23H23F3N6O3 — CID 51351899
5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,19,28-hexazatetracyclo[19.2.2.210,13.13,7]octacosa-1(23),3,5,7(28),10(27),11,13(26),21,24-nonaen-20-one (PubChem CID 51351899) has the molecular formula C23H23F3N6O3 and a molecular weight of 488.47 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,19,28-hexazatetracyclo[19.2.2.210,13.13,7]octacosa-1(23),3,5,7(28),10(27),11,13(26),21,24-nonaen-20-one.
| Compound Name | 5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,19,28-hexazatetracyclo[19.2.2.210,13.13,7]octacosa-1(23),3,5,7(28),10(27),11,13(26),21,24-nonaen-20-one |
|---|---|
| PubChem CID | 51351899 |
| Molecular Formula | C23H23F3N6O3 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,19,28-hexazatetracyclo[19.2.2.210,13.13,7]octacosa-1(23),3,5,7(28),10(27),11,13(26),21,24-nonaen-20-one |
| SMILES | O=C1NCCCCOc2ccc(cc2)CNc2nc(nc(OCC(F)(F)F)n2)Nc2ccc1cc2 |
| InChI | InChI=1S/C23H23F3N6O3/c24-23(25,26)14-35-22-31-20-28-13-15-3-9-18(10-4-15)34-12-2-1-11-27-19(33)16-5-7-17(8-6-16)29-21(30-20)32-22/h3-10H,1-2,11-14H2,(H,27,33)(H2,28,29,30,31,32) |
| InChIKey | FHPBQBACTIAHMX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |