C20H15F3N4O4 — CID 156831448
N-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]benzamide (PubChem CID 156831448) has the molecular formula C20H15F3N4O4 and a molecular weight of 432.36 g/mol. Its IUPAC name is N-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]benzamide.
| Compound Name | N-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]benzamide |
|---|---|
| PubChem CID | 156831448 |
| Molecular Formula | C20H15F3N4O4 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]benzamide |
| SMILES | O=C(NCOc1nc(Nc2ccc3c(c2)OCO3)ncc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C20H15F3N4O4/c21-20(22,23)14-9-24-19(26-13-6-7-15-16(8-13)31-11-30-15)27-18(14)29-10-25-17(28)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,25,28)(H,24,26,27) |
| InChIKey | MAGJNBDWVLWJTJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|