C24H28BN5O5 — CID 156831484
CID 156831484 (PubChem CID 156831484) has the molecular formula C24H28BN5O5 and a molecular weight of 477.33 g/mol.
| Compound Name | CID 156831484 |
|---|---|
| PubChem CID | 156831484 |
| Molecular Formula | C24H28BN5O5 |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cc(OC)c(OC)c(OC)c2)nc1Oc1ccccc1C(=O)NCCN(C)C |
| InChI | InChI=1S/C24H28BN5O5/c1-30(2)11-10-26-22(31)16-8-6-7-9-18(16)35-23-17(25)14-27-24(29-23)28-15-12-19(32-3)21(34-5)20(13-15)33-4/h6-9,12-14H,10-11H2,1-5H3,(H,26,31)(H,27,28,29) |
| InChIKey | YDNVUGQXJLDDBE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|