C22H15N3O4 — CID 156834079
3-[1-[4-(1,3-benzodioxol-5-yl)phenyl]triazol-4-yl]benzoic acid (PubChem CID 156834079) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is 3-[1-[4-(1,3-benzodioxol-5-yl)phenyl]triazol-4-yl]benzoic acid.
| Compound Name | 3-[1-[4-(1,3-benzodioxol-5-yl)phenyl]triazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 156834079 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-[1-[4-(1,3-benzodioxol-5-yl)phenyl]triazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cn(-c3ccc(-c4ccc5c(c4)OCO5)cc3)nn2)c1 |
| InChI | InChI=1S/C22H15N3O4/c26-22(27)17-3-1-2-16(10-17)19-12-25(24-23-19)18-7-4-14(5-8-18)15-6-9-20-21(11-15)29-13-28-20/h1-12H,13H2,(H,26,27) |
| InChIKey | GYGWUVYMPQOHKT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |