About ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate
ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate (PubChem CID 156835184) has the molecular formula C21H29N2O6P
and a molecular weight of 436.45 g/mol. Its IUPAC name is ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate.
Molecular Properties
| Compound Name | ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate |
| PubChem CID | 156835184 |
| Molecular Formula | C21H29N2O6P |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate |
| SMILES | CC.CCC(CC)OC(=O)CNP(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H23N2O6P.C2H6/c1-3-16(4-2)25-19(22)14-20-28(26-17-8-6-5-7-9-17)27-18-12-10-15(11-13-18)21(23)24;1-2/h5-13,16,20H,3-4,14H2,1-2H3;1-2H3 |
| InChIKey | ADEVSTWRELOBFH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate?
The IUPAC name of ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate (CID 156835184) is ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate.
What is the SMILES notation for ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate?
The canonical SMILES for ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate is CC.CCC(CC)OC(=O)CNP(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate?
The InChIKey is ADEVSTWRELOBFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N2O6P.C2H6/c1-3-16(4-2)25-19(22)14-20-28(26-17-8-6-5-7-9-17)27-18-12-10-15(11-13-18)21(23)24;1-2/h5-13,16,20H,3-4,14H2,1-2H3;1-2H3.
What are the key properties of ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate?
ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate has a molecular weight of 436.45 g/mol, XLogP of 5.63, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pentan-3-yl 2-[[(4-nitrophenoxy)-phenoxyphosphanyl]amino]acetate is sourced from PubChem (CID 156835184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).