C15H30FN3 — CID 156836674
ethane;7-[(1-fluoropyrrolidin-3-yl)methyl]-2-methyl-2,7-diazaspiro[3.5]nonane (PubChem CID 156836674) has the molecular formula C15H30FN3 and a molecular weight of 271.42 g/mol. Its IUPAC name is ethane;7-[(1-fluoropyrrolidin-3-yl)methyl]-2-methyl-2,7-diazaspiro[3.5]nonane.
| Compound Name | ethane;7-[(1-fluoropyrrolidin-3-yl)methyl]-2-methyl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 156836674 |
| Molecular Formula | C15H30FN3 |
| Molecular Weight | 271.42 g/mol |
| Exact Mass | 271.24 |
| IUPAC Name | ethane;7-[(1-fluoropyrrolidin-3-yl)methyl]-2-methyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.CN1CC2(CCN(CC3CCN(F)C3)CC2)C1 |
| InChI | InChI=1S/C13H24FN3.C2H6/c1-15-10-13(11-15)3-6-16(7-4-13)8-12-2-5-17(14)9-12;1-2/h12H,2-11H2,1H3;1-2H3 |
| InChIKey | PJUGWEWBPDHKSS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|