C15H30N3+ — CID 177319175
[1-[(2-methyl-2-azaspiro[3.5]nonan-7-yl)methyl]piperidin-4-yl]azanium (PubChem CID 177319175) has the molecular formula C15H30N3+ and a molecular weight of 252.43 g/mol. Its IUPAC name is [1-[(2-methyl-2-azaspiro[3.5]nonan-7-yl)methyl]piperidin-4-yl]azanium.
| Compound Name | [1-[(2-methyl-2-azaspiro[3.5]nonan-7-yl)methyl]piperidin-4-yl]azanium |
|---|---|
| PubChem CID | 177319175 |
| Molecular Formula | C15H30N3+ |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.24 |
| IUPAC Name | [1-[(2-methyl-2-azaspiro[3.5]nonan-7-yl)methyl]piperidin-4-yl]azanium |
| SMILES | CN1CC2(CCC(CN3CCC([NH3+])CC3)CC2)C1 |
| InChI | InChI=1S/C15H29N3/c1-17-11-15(12-17)6-2-13(3-7-15)10-18-8-4-14(16)5-9-18/h13-14H,2-12,16H2,1H3/p+1 |
| InChIKey | YZNZWUQNKARVTQ-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 34.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |