C21H41N3 — CID 176795458
2-tert-butyl-7-[(4-tert-butylpiperazin-1-yl)methyl]-2-azaspiro[3.5]nonane (PubChem CID 176795458) has the molecular formula C21H41N3 and a molecular weight of 335.58 g/mol. Its IUPAC name is 2-tert-butyl-7-[(4-tert-butylpiperazin-1-yl)methyl]-2-azaspiro[3.5]nonane.
| Compound Name | 2-tert-butyl-7-[(4-tert-butylpiperazin-1-yl)methyl]-2-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 176795458 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 2-tert-butyl-7-[(4-tert-butylpiperazin-1-yl)methyl]-2-azaspiro[3.5]nonane |
| SMILES | CC(C)(C)N1CCN(CC2CCC3(CC2)CN(C(C)(C)C)C3)CC1 |
| InChI | InChI=1S/C21H41N3/c1-19(2,3)23-13-11-22(12-14-23)15-18-7-9-21(10-8-18)16-24(17-21)20(4,5)6/h18H,7-17H2,1-6H3 |
| InChIKey | BDJOGIITNHAUAI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |