C7H11NO5 — CID 156837656
methyl 3,3-dihydroxy-4-methyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 156837656) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is methyl 3,3-dihydroxy-4-methyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl 3,3-dihydroxy-4-methyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 156837656 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | methyl 3,3-dihydroxy-4-methyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1NC(=O)C(C)C1(O)O |
| InChI | InChI=1S/C7H11NO5/c1-3-5(9)8-4(6(10)13-2)7(3,11)12/h3-4,11-12H,1-2H3,(H,8,9) |
| InChIKey | AWZJRVZXGJQPJR-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|