C23H24F3N5O — CID 156838054
N-[(1S,2S)-2-[(3aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 156838054) has the molecular formula C23H24F3N5O and a molecular weight of 443.47 g/mol. Its IUPAC name is N-[(1S,2S)-2-[(3aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1S,2S)-2-[(3aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156838054 |
| Molecular Formula | C23H24F3N5O |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[(1S,2S)-2-[(3aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc2c(N[C@H]3c4ccccc4CC[C@@H]3N3CC4COC[C@H]4C3)ncnc2[nH]1 |
| InChI | InChI=1S/C23H24F3N5O/c24-23(25,26)19-7-17-21(29-19)27-12-28-22(17)30-20-16-4-2-1-3-13(16)5-6-18(20)31-8-14-10-32-11-15(14)9-31/h1-4,7,12,14-15,18,20H,5-6,8-11H2,(H2,27,28,29,30)/t14-,15?,18+,20+/m1/s1 |
| InChIKey | VBYWZZZJPKUZGP-AWUYRKIDSA-N |
| XLogP | 4.02 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |