C22H23F3N4O — CID 156837959
N-[(1R,2S)-2-(oxan-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 156837959) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is N-[(1R,2S)-2-(oxan-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1R,2S)-2-(oxan-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156837959 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[(1R,2S)-2-(oxan-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc2c(N[C@H]3c4ccccc4CC[C@H]3C3CCOCC3)ncnc2[nH]1 |
| InChI | InChI=1S/C22H23F3N4O/c23-22(24,25)18-11-17-20(28-18)26-12-27-21(17)29-19-15-4-2-1-3-13(15)5-6-16(19)14-7-9-30-10-8-14/h1-4,11-12,14,16,19H,5-10H2,(H2,26,27,28,29)/t16-,19-/m0/s1 |
| InChIKey | UEQBLPVKDVNCKA-LPHOPBHVSA-N |
| XLogP | 5.12 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |