C22H26N4O2 — CID 174168228
6-methyl-N-[(1S,2R)-2-(oxan-4-yloxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 174168228) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 6-methyl-N-[(1S,2R)-2-(oxan-4-yloxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-[(1S,2R)-2-(oxan-4-yloxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 174168228 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 6-methyl-N-[(1S,2R)-2-(oxan-4-yloxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(N[C@H]3c4ccccc4CC[C@H]3OC3CCOCC3)ncnc2[nH]1 |
| InChI | InChI=1S/C22H26N4O2/c1-14-12-18-21(25-14)23-13-24-22(18)26-20-17-5-3-2-4-15(17)6-7-19(20)28-16-8-10-27-11-9-16/h2-5,12-13,16,19-20H,6-11H2,1H3,(H2,23,24,25,26)/t19-,20+/m1/s1 |
| InChIKey | CYPDLQSRUVSUSB-UXHICEINSA-N |
| XLogP | 3.93 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |