C24H31N5O — CID 174168257
(1S,2S)-2-N-methyl-1-N-(6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-N-(oxan-4-ylmethyl)-1,2,3,4-tetrahydronaphthalene-1,2-diamine (PubChem CID 174168257) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is (1S,2S)-2-N-methyl-1-N-(6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-N-(oxan-4-ylmethyl)-1,2,3,4-tetrahydronaphthalene-1,2-diamine.
| Compound Name | (1S,2S)-2-N-methyl-1-N-(6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-N-(oxan-4-ylmethyl)-1,2,3,4-tetrahydronaphthalene-1,2-diamine |
|---|---|
| PubChem CID | 174168257 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | (1S,2S)-2-N-methyl-1-N-(6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-N-(oxan-4-ylmethyl)-1,2,3,4-tetrahydronaphthalene-1,2-diamine |
| SMILES | Cc1cc2c(N[C@H]3c4ccccc4CC[C@@H]3N(C)CC3CCOCC3)ncnc2[nH]1 |
| InChI | InChI=1S/C24H31N5O/c1-16-13-20-23(27-16)25-15-26-24(20)28-22-19-6-4-3-5-18(19)7-8-21(22)29(2)14-17-9-11-30-12-10-17/h3-6,13,15,17,21-22H,7-12,14H2,1-2H3,(H2,25,26,27,28)/t21-,22-/m0/s1 |
| InChIKey | KIUUBPGREWVNLS-VXKWHMMOSA-N |
| XLogP | 4.09 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |