C13H31N3O2 — CID 156839791
1,1-bis(2-methoxyethyl)-2-methyl-3-propylguanidine;ethane (PubChem CID 156839791) has the molecular formula C13H31N3O2 and a molecular weight of 261.41 g/mol. Its IUPAC name is 1,1-bis(2-methoxyethyl)-2-methyl-3-propylguanidine;ethane.
| Compound Name | 1,1-bis(2-methoxyethyl)-2-methyl-3-propylguanidine;ethane |
|---|---|
| PubChem CID | 156839791 |
| Molecular Formula | C13H31N3O2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.24 |
| IUPAC Name | 1,1-bis(2-methoxyethyl)-2-methyl-3-propylguanidine;ethane |
| SMILES | CC.CCCN/C(=N\C)N(CCOC)CCOC |
| InChI | InChI=1S/C11H25N3O2.C2H6/c1-5-6-13-11(12-2)14(7-9-15-3)8-10-16-4;1-2/h5-10H2,1-4H3,(H,12,13);1-2H3 |
| InChIKey | CFCSSXANDSVWOM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|