C12H26F3IN4O — CID 110941609
1-ethyl-3-(2-methoxyethyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide (PubChem CID 110941609) has the molecular formula C12H26F3IN4O and a molecular weight of 426.27 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyethyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methoxyethyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110941609 |
| Molecular Formula | C12H26F3IN4O |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-ethyl-3-(2-methoxyethyl)-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)NCCOC.I |
| InChI | InChI=1S/C12H25F3N4O.HI/c1-4-16-11(18-7-9-20-3)17-6-5-8-19(2)10-12(13,14)15;/h4-10H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | LRDIIXVEVBSXFJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|