C22H24N2O3 — CID 156840873
6-[(Z)-pent-3-en-2-yl]-9-phenylmethoxy-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-7,10-dione (PubChem CID 156840873) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-[(Z)-pent-3-en-2-yl]-9-phenylmethoxy-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-7,10-dione.
| Compound Name | 6-[(Z)-pent-3-en-2-yl]-9-phenylmethoxy-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-7,10-dione |
|---|---|
| PubChem CID | 156840873 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 6-[(Z)-pent-3-en-2-yl]-9-phenylmethoxy-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-7,10-dione |
| SMILES | C/C=C\C(C)N1CC2CCc3cc(=O)c(OCc4ccccc4)c(n32)C1=O |
| InChI | InChI=1S/C22H24N2O3/c1-3-7-15(2)23-13-18-11-10-17-12-19(25)21(20(22(23)26)24(17)18)27-14-16-8-5-4-6-9-16/h3-9,12,15,18H,10-11,13-14H2,1-2H3/b7-3- |
| InChIKey | TVYKOIVLJFMZSD-CLTKARDFSA-N |
| XLogP | 3.34 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|