C22H22N2O5 — CID 134573086
(1R,2R)-15-hydroxy-11-phenylmethoxy-3-oxa-8,17-diazapentacyclo[8.6.1.14,7.02,8.014,17]octadeca-10,13-diene-9,12-dione (PubChem CID 134573086) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (1R,2R)-15-hydroxy-11-phenylmethoxy-3-oxa-8,17-diazapentacyclo[8.6.1.14,7.02,8.014,17]octadeca-10,13-diene-9,12-dione.
| Compound Name | (1R,2R)-15-hydroxy-11-phenylmethoxy-3-oxa-8,17-diazapentacyclo[8.6.1.14,7.02,8.014,17]octadeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 134573086 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (1R,2R)-15-hydroxy-11-phenylmethoxy-3-oxa-8,17-diazapentacyclo[8.6.1.14,7.02,8.014,17]octadeca-10,13-diene-9,12-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)cc3n2[C@H](CC3O)[C@H]2OC3CCC(C3)N12 |
| InChI | InChI=1S/C22H22N2O5/c25-17-10-16-22-23(13-6-7-14(8-13)29-22)21(27)19-20(18(26)9-15(17)24(16)19)28-11-12-4-2-1-3-5-12/h1-5,9,13-14,16-17,22,25H,6-8,10-11H2/t13?,14?,16-,17?,22-/m1/s1 |
| InChIKey | KAIRPKVLMVIZSI-UFARQNQASA-N |
| XLogP | 2.14 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |